C24H19Cl4N3O4 — CID 18621249
ethyl 3-(2,6-dichloroanilino)-2-[[3-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-3-oxopropanoate (PubChem CID 18621249) has the molecular formula C24H19Cl4N3O4 and a molecular weight of 555.25 g/mol. Its IUPAC name is ethyl 3-(2,6-dichloroanilino)-2-[[3-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-(2,6-dichloroanilino)-2-[[3-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 18621249 |
| Molecular Formula | C24H19Cl4N3O4 |
| Molecular Weight | 555.25 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | ethyl 3-(2,6-dichloroanilino)-2-[[3-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cccc(NC(=O)c2c(Cl)cncc2Cl)c1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19Cl4N3O4/c1-2-35-24(34)15(22(32)31-21-16(25)7-4-8-17(21)26)10-13-5-3-6-14(9-13)30-23(33)20-18(27)11-29-12-19(20)28/h3-9,11-12,15H,2,10H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | GMJAQCURIHOEGZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.25 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|