About 1-hydroxyethylthiourea
1-hydroxyethylthiourea (PubChem CID 18621685) has the molecular formula C3H8N2OS
and a molecular weight of 120.18 g/mol. Its IUPAC name is 1-hydroxyethylthiourea.
Molecular Properties
| Compound Name | 1-hydroxyethylthiourea |
| PubChem CID | 18621685 |
| Molecular Formula | C3H8N2OS |
| Molecular Weight | 120.18 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 1-hydroxyethylthiourea |
| SMILES | CC(O)NC(N)=S |
| InChI | InChI=1S/C3H8N2OS/c1-2(6)5-3(4)7/h2,6H,1H3,(H3,4,5,7) |
| InChIKey | YVNRKXUWXHWAIH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.18 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethylthiourea?
The IUPAC name of 1-hydroxyethylthiourea (CID 18621685) is 1-hydroxyethylthiourea.
What is the SMILES notation for 1-hydroxyethylthiourea?
The canonical SMILES for 1-hydroxyethylthiourea is CC(O)NC(N)=S.
What is the InChIKey of 1-hydroxyethylthiourea?
The InChIKey is YVNRKXUWXHWAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2OS/c1-2(6)5-3(4)7/h2,6H,1H3,(H3,4,5,7).
What are the key properties of 1-hydroxyethylthiourea?
1-hydroxyethylthiourea has a molecular weight of 120.18 g/mol, XLogP of -0.84, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethylthiourea is sourced from PubChem (CID 18621685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).