About N-but-1-en-2-ylacetamide
N-but-1-en-2-ylacetamide (PubChem CID 18622233) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is N-but-1-en-2-ylacetamide.
Molecular Properties
| Compound Name | N-but-1-en-2-ylacetamide |
| PubChem CID | 18622233 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | N-but-1-en-2-ylacetamide |
| SMILES | C=C(CC)NC(C)=O |
| InChI | InChI=1S/C6H11NO/c1-4-5(2)7-6(3)8/h2,4H2,1,3H3,(H,7,8) |
| InChIKey | FSNXYJBYYNRTMG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-but-1-en-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-ylacetamide?
The IUPAC name of N-but-1-en-2-ylacetamide (CID 18622233) is N-but-1-en-2-ylacetamide.
What is the SMILES notation for N-but-1-en-2-ylacetamide?
The canonical SMILES for N-but-1-en-2-ylacetamide is C=C(CC)NC(C)=O.
What is the InChIKey of N-but-1-en-2-ylacetamide?
The InChIKey is FSNXYJBYYNRTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-4-5(2)7-6(3)8/h2,4H2,1,3H3,(H,7,8).
What are the key properties of N-but-1-en-2-ylacetamide?
N-but-1-en-2-ylacetamide has a molecular weight of 113.16 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-ylacetamide is sourced from PubChem (CID 18622233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).