About 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine
3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine (PubChem CID 18622249) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine |
| PubChem CID | 18622249 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine |
| SMILES | CC1(CCCN)C2C=CC(C2)C1(C)CCCN |
| InChI | InChI=1S/C15H28N2/c1-14(7-3-9-16)12-5-6-13(11-12)15(14,2)8-4-10-17/h5-6,12-13H,3-4,7-11,16-17H2,1-2H3 |
| InChIKey | MJACFKOMEAKANB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine?
The IUPAC name of 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine (CID 18622249) is 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine.
What is the SMILES notation for 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine?
The canonical SMILES for 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine is CC1(CCCN)C2C=CC(C2)C1(C)CCCN.
What is the InChIKey of 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine?
The InChIKey is MJACFKOMEAKANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2/c1-14(7-3-9-16)12-5-6-13(11-12)15(14,2)8-4-10-17/h5-6,12-13H,3-4,7-11,16-17H2,1-2H3.
What are the key properties of 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine?
3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine has a molecular weight of 236.40 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-aminopropyl)-2,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]propan-1-amine is sourced from PubChem (CID 18622249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).