About 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane
2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane (PubChem CID 18622418) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane.
Molecular Properties
| Compound Name | 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane |
| PubChem CID | 18622418 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane |
| SMILES | CC1OC1(C)C(C)(C)OC(C)(C)C1(C)OC1C |
| InChI | InChI=1S/C14H26O3/c1-9-13(7,15-9)11(3,4)17-12(5,6)14(8)10(2)16-14/h9-10H,1-8H3 |
| InChIKey | JTHOLCFQDHELCM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane?
The IUPAC name of 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane (CID 18622418) is 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane.
What is the SMILES notation for 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane?
The canonical SMILES for 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane is CC1OC1(C)C(C)(C)OC(C)(C)C1(C)OC1C.
What is the InChIKey of 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane?
The InChIKey is JTHOLCFQDHELCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-9-13(7,15-9)11(3,4)17-12(5,6)14(8)10(2)16-14/h9-10H,1-8H3.
What are the key properties of 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane?
2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane has a molecular weight of 242.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,3-dimethyloxiran-2-yl)propan-2-yloxy]propan-2-yl]-2,3-dimethyloxirane is sourced from PubChem (CID 18622418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).