About cyclohexen-1-yl cyclohexanecarboxylate
cyclohexen-1-yl cyclohexanecarboxylate (PubChem CID 18622426) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclohexen-1-yl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | cyclohexen-1-yl cyclohexanecarboxylate |
| PubChem CID | 18622426 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | cyclohexen-1-yl cyclohexanecarboxylate |
| SMILES | O=C(OC1=CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H20O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h9,11H,1-8,10H2 |
| InChIKey | PTXGLLNCVRLSRI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexen-1-yl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-yl cyclohexanecarboxylate?
The IUPAC name of cyclohexen-1-yl cyclohexanecarboxylate (CID 18622426) is cyclohexen-1-yl cyclohexanecarboxylate.
What is the SMILES notation for cyclohexen-1-yl cyclohexanecarboxylate?
The canonical SMILES for cyclohexen-1-yl cyclohexanecarboxylate is O=C(OC1=CCCCC1)C1CCCCC1.
What is the InChIKey of cyclohexen-1-yl cyclohexanecarboxylate?
The InChIKey is PTXGLLNCVRLSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h9,11H,1-8,10H2.
What are the key properties of cyclohexen-1-yl cyclohexanecarboxylate?
cyclohexen-1-yl cyclohexanecarboxylate has a molecular weight of 208.30 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-yl cyclohexanecarboxylate is sourced from PubChem (CID 18622426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).