About argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium
argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium (PubChem CID 18622589) has the molecular formula C11H16ArN5O+
and a molecular weight of 274.23 g/mol. Its IUPAC name is argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium.
Molecular Properties
| Compound Name | argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium |
| PubChem CID | 18622589 |
| Molecular Formula | C11H16ArN5O+ |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium |
| SMILES | CN(C)C(On1nnc2ccccc21)=[N+](C)C.[Ar] |
| InChI | InChI=1S/C11H16N5O.Ar/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;/h5-8H,1-4H3;/q+1; |
| InChIKey | KSPNXIMFWKUWFR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium?
The IUPAC name of argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium (CID 18622589) is argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium.
What is the SMILES notation for argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium?
The canonical SMILES for argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium is CN(C)C(On1nnc2ccccc21)=[N+](C)C.[Ar].
What is the InChIKey of argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium?
The InChIKey is KSPNXIMFWKUWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N5O.Ar/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;/h5-8H,1-4H3;/q+1;.
What are the key properties of argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium?
argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium has a molecular weight of 274.23 g/mol, XLogP of 0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for argon;[benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium is sourced from PubChem (CID 18622589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).