C34H52OSi — CID 18622624
3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-trimethylsilane (PubChem CID 18622624) has the molecular formula C34H52OSi and a molecular weight of 504.88 g/mol. Its IUPAC name is 3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-trimethylsilane.
| Compound Name | 3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-trimethylsilane |
|---|---|
| PubChem CID | 18622624 |
| Molecular Formula | C34H52OSi |
| Molecular Weight | 504.88 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | 3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-trimethylsilane |
| SMILES | CCC(CCO[Si](C)(C)C)(C1C2C=CC=CC2C2CCCCC21)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C34H52OSi/c1-5-34(22-23-35-36(2,3)4,32-28-18-10-6-14-24(28)25-15-7-11-19-29(25)32)33-30-20-12-8-16-26(30)27-17-9-13-21-31(27)33/h6,8,10,12,14,16,18,20,24-33H,5,7,9,11,13,15,17,19,21-23H2,1-4H3 |
| InChIKey | ZITLPRBISLVHEG-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.88 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|