C43H72O2Si2 — CID 18622634
[2,2-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-triethylsilyloxypentoxy]-triethylsilane (PubChem CID 18622634) has the molecular formula C43H72O2Si2 and a molecular weight of 677.22 g/mol. Its IUPAC name is [2,2-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-triethylsilyloxypentoxy]-triethylsilane.
| Compound Name | [2,2-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
|---|---|
| PubChem CID | 18622634 |
| Molecular Formula | C43H72O2Si2 |
| Molecular Weight | 677.22 g/mol |
| Exact Mass | 676.51 |
| IUPAC Name | [2,2-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCCC(CO[Si](CC)(CC)CC)(C1C2C=CC=CC2C2CCCCC21)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C43H72O2Si2/c1-7-46(8-2,9-3)44-31-21-30-43(32-45-47(10-4,11-5)12-6,41-37-26-17-13-22-33(37)34-23-14-18-27-38(34)41)42-39-28-19-15-24-35(39)36-25-16-20-29-40(36)42/h13,15,17,19,22,24,26,28,33-42H,7-12,14,16,18,20-21,23,25,27,29-32H2,1-6H3 |
| InChIKey | IKSMALYKJCRSCR-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.22 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|