C22H34OSi — CID 18622641
[3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-trimethylsilane (PubChem CID 18622641) has the molecular formula C22H34OSi and a molecular weight of 342.60 g/mol. Its IUPAC name is [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-trimethylsilane.
| Compound Name | [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 18622641 |
| Molecular Formula | C22H34OSi |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-trimethylsilane |
| SMILES | CCC(CCO[Si](C)(C)C)(C1=CC=CC1)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C22H34OSi/c1-5-22(19-11-7-8-12-19,16-17-23-24(2,3)4)21-15-14-18-10-6-9-13-20(18)21/h6-11,13,18,20-21H,5,12,14-17H2,1-4H3 |
| InChIKey | PVURDFDGARXONQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|