C27H48O2Si2 — CID 18622663
[3,3-di(cyclopenta-1,3-dien-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane (PubChem CID 18622663) has the molecular formula C27H48O2Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is [3,3-di(cyclopenta-1,3-dien-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane.
| Compound Name | [3,3-di(cyclopenta-1,3-dien-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
|---|---|
| PubChem CID | 18622663 |
| Molecular Formula | C27H48O2Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [3,3-di(cyclopenta-1,3-dien-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCC(CCO[Si](CC)(CC)CC)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C27H48O2Si2/c1-7-30(8-2,9-3)28-23-21-27(25-17-13-14-18-25,26-19-15-16-20-26)22-24-29-31(10-4,11-5)12-6/h13-17,19H,7-12,18,20-24H2,1-6H3 |
| InChIKey | OZKPCEPNEQGNSU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|