C37H60O2Si2 — CID 18622669
[3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane (PubChem CID 18622669) has the molecular formula C37H60O2Si2 and a molecular weight of 593.06 g/mol. Its IUPAC name is [3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane.
| Compound Name | [3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 18622669 |
| Molecular Formula | C37H60O2Si2 |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.41 |
| IUPAC Name | [3,3-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OCCC(CCO[Si](C)(C)C)(C1C2C=CC=CC2C2CCCCC21)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C37H60O2Si2/c1-40(2,3)38-25-23-37(24-26-39-41(4,5)6,35-31-19-11-7-15-27(31)28-16-8-12-20-32(28)35)36-33-21-13-9-17-29(33)30-18-10-14-22-34(30)36/h7,9,11,13,15,17,19,21,27-36H,8,10,12,14,16,18,20,22-26H2,1-6H3 |
| InChIKey | CJEPATVFRQGGNT-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|