C37H58OSi — CID 18622695
4,4-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-triethylsilane (PubChem CID 18622695) has the molecular formula C37H58OSi and a molecular weight of 546.96 g/mol. Its IUPAC name is 4,4-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-triethylsilane.
| Compound Name | 4,4-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-triethylsilane |
|---|---|
| PubChem CID | 18622695 |
| Molecular Formula | C37H58OSi |
| Molecular Weight | 546.96 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | 4,4-bis(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)pentoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCCC(C)(C1C2C=CC=CC2C2CCCCC21)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C37H58OSi/c1-5-39(6-2,7-3)38-26-16-25-37(4,35-31-21-12-8-17-27(31)28-18-9-13-22-32(28)35)36-33-23-14-10-19-29(33)30-20-11-15-24-34(30)36/h8,10,12,14,17,19,21,23,27-36H,5-7,9,11,13,15-16,18,20,22,24-26H2,1-4H3 |
| InChIKey | ZCOCQAIUCGQYJI-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.96 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|