C29H48O2Si2 — CID 18622702
[2,2-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane (PubChem CID 18622702) has the molecular formula C29H48O2Si2 and a molecular weight of 484.87 g/mol. Its IUPAC name is [2,2-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane.
| Compound Name | [2,2-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 18622702 |
| Molecular Formula | C29H48O2Si2 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [2,2-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OCCCC(CO[Si](C)(C)C)(C1CCC2C=CC=CC21)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C29H48O2Si2/c1-32(2,3)30-21-11-20-29(22-31-33(4,5)6,27-18-16-23-12-7-9-14-25(23)27)28-19-17-24-13-8-10-15-26(24)28/h7-10,12-15,23-28H,11,16-22H2,1-6H3 |
| InChIKey | JOUDLGJOLBTXHP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|