C25H40OSi — CID 18622714
[3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane (PubChem CID 18622714) has the molecular formula C25H40OSi and a molecular weight of 384.68 g/mol. Its IUPAC name is [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane.
| Compound Name | [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane |
|---|---|
| PubChem CID | 18622714 |
| Molecular Formula | C25H40OSi |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | [3-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane |
| SMILES | CCC(CCO[Si](CC)(CC)CC)(C1=CC=CC1)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C25H40OSi/c1-5-25(22-14-10-11-15-22,19-20-26-27(6-2,7-3)8-4)24-18-17-21-13-9-12-16-23(21)24/h9-14,16,21,23-24H,5-8,15,17-20H2,1-4H3 |
| InChIKey | VWRJJPLBRHEIJR-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|