C21H36O2Si2 — CID 18622720
[2,2-di(cyclopenta-1,3-dien-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane (PubChem CID 18622720) has the molecular formula C21H36O2Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is [2,2-di(cyclopenta-1,3-dien-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane.
| Compound Name | [2,2-di(cyclopenta-1,3-dien-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 18622720 |
| Molecular Formula | C21H36O2Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [2,2-di(cyclopenta-1,3-dien-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OCCCC(CO[Si](C)(C)C)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C21H36O2Si2/c1-24(2,3)22-17-11-16-21(18-23-25(4,5)6,19-12-7-8-13-19)20-14-9-10-15-20/h7-10,12,14H,11,13,15-18H2,1-6H3 |
| InChIKey | PSCQVIVKVQNECE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|