C35H60O2Si2 — CID 18622730
[3,3-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane (PubChem CID 18622730) has the molecular formula C35H60O2Si2 and a molecular weight of 569.04 g/mol. Its IUPAC name is [3,3-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane.
| Compound Name | [3,3-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
|---|---|
| PubChem CID | 18622730 |
| Molecular Formula | C35H60O2Si2 |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | [3,3-bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-5-triethylsilyloxypentoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCC(CCO[Si](CC)(CC)CC)(C1CCC2C=CC=CC21)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C35H60O2Si2/c1-7-38(8-2,9-3)36-27-25-35(26-28-37-39(10-4,11-5)12-6,33-23-21-29-17-13-15-19-31(29)33)34-24-22-30-18-14-16-20-32(30)34/h13-20,29-34H,7-12,21-28H2,1-6H3 |
| InChIKey | POHVIJRAYRSEKF-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|