C21H22N4O7 — CID 18623476
6-(3,4-dimethoxyphenyl)-2-[(2,3-dinitrophenyl)methyl]-5-ethyl-4,5-dihydropyridazin-3-one (PubChem CID 18623476) has the molecular formula C21H22N4O7 and a molecular weight of 442.43 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-2-[(2,3-dinitrophenyl)methyl]-5-ethyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-2-[(2,3-dinitrophenyl)methyl]-5-ethyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 18623476 |
| Molecular Formula | C21H22N4O7 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-2-[(2,3-dinitrophenyl)methyl]-5-ethyl-4,5-dihydropyridazin-3-one |
| SMILES | CCC1CC(=O)N(Cc2cccc([N+](=O)[O-])c2[N+](=O)[O-])N=C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O7/c1-4-13-11-19(26)23(12-15-6-5-7-16(24(27)28)21(15)25(29)30)22-20(13)14-8-9-17(31-2)18(10-14)32-3/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | CYSSWZNZTHTWOQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 137.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|