About piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride
piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride (PubChem CID 18623795) has the molecular formula C11H22ClN3O2
and a molecular weight of 263.77 g/mol. Its IUPAC name is piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride |
| PubChem CID | 18623795 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCC1CNCCN1)N1CCCCC1 |
| InChI | InChI=1S/C11H21N3O2.ClH/c15-11(14-6-2-1-3-7-14)16-9-10-8-12-4-5-13-10;/h10,12-13H,1-9H2;1H |
| InChIKey | CAPYBMQJYFMNNM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride?
The IUPAC name of piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride (CID 18623795) is piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride.
What is the SMILES notation for piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride?
The canonical SMILES for piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride is Cl.O=C(OCC1CNCCN1)N1CCCCC1.
What is the InChIKey of piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride?
The InChIKey is CAPYBMQJYFMNNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2.ClH/c15-11(14-6-2-1-3-7-14)16-9-10-8-12-4-5-13-10;/h10,12-13H,1-9H2;1H.
What are the key properties of piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride?
piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride has a molecular weight of 263.77 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-2-ylmethyl piperidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 18623795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).