C22H24F6O4 — CID 18623931
7-[2-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 18623931) has the molecular formula C22H24F6O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is 7-[2-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18623931 |
| Molecular Formula | C22H24F6O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 7-[2-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)C1/C=C/c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H24F6O4/c23-21(24,25)16-7-5-8-17(22(26,27)28)15(16)11-10-14-13(18(29)12-19(14)30)6-3-1-2-4-9-20(31)32/h5,7-8,10-11,13-14,19,30H,1-4,6,9,12H2,(H,31,32)/b11-10+ |
| InChIKey | DBNCOHYYVBRKEB-ZHACJKMWSA-N |
| XLogP | 5.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|