About 1H-benzimidazole-4,5-dione
1H-benzimidazole-4,5-dione (PubChem CID 18624211) has the molecular formula C7H4N2O2
and a molecular weight of 148.12 g/mol. Its IUPAC name is 1H-benzimidazole-4,5-dione.
Molecular Properties
| Compound Name | 1H-benzimidazole-4,5-dione |
| PubChem CID | 18624211 |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 1H-benzimidazole-4,5-dione |
| SMILES | O=C1C=Cc2[nH]cnc2C1=O |
| InChI | InChI=1S/C7H4N2O2/c10-5-2-1-4-6(7(5)11)9-3-8-4/h1-3H,(H,8,9) |
| InChIKey | GKSHTLKPOFLVHM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole-4,5-dione?
The IUPAC name of 1H-benzimidazole-4,5-dione (CID 18624211) is 1H-benzimidazole-4,5-dione.
What is the SMILES notation for 1H-benzimidazole-4,5-dione?
The canonical SMILES for 1H-benzimidazole-4,5-dione is O=C1C=Cc2[nH]cnc2C1=O.
What is the InChIKey of 1H-benzimidazole-4,5-dione?
The InChIKey is GKSHTLKPOFLVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2/c10-5-2-1-4-6(7(5)11)9-3-8-4/h1-3H,(H,8,9).
What are the key properties of 1H-benzimidazole-4,5-dione?
1H-benzimidazole-4,5-dione has a molecular weight of 148.12 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole-4,5-dione is sourced from PubChem (CID 18624211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).