C8H14S6 — CID 18624302
4,9-dimethyl-1,2,5,8,11,12-hexathiaspiro[5.6]dodecane (PubChem CID 18624302) has the molecular formula C8H14S6 and a molecular weight of 302.60 g/mol. Its IUPAC name is 4,9-dimethyl-1,2,5,8,11,12-hexathiaspiro[5.6]dodecane.
| Compound Name | 4,9-dimethyl-1,2,5,8,11,12-hexathiaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 18624302 |
| Molecular Formula | C8H14S6 |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 4,9-dimethyl-1,2,5,8,11,12-hexathiaspiro[5.6]dodecane |
| SMILES | CC1CSSC2(CS1)SSCC(C)S2 |
| InChI | InChI=1S/C8H14S6/c1-6-3-10-13-8(5-9-6)12-7(2)4-11-14-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | SNAHXBFFPNISFT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|