About N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide
N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide (PubChem CID 18624450) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide |
| PubChem CID | 18624450 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C(NCCCCCCO)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H21NO4/c23-12-6-2-1-5-11-22-21(26)14-9-10-17-18(13-14)20(25)16-8-4-3-7-15(16)19(17)24/h3-4,7-10,13,23H,1-2,5-6,11-12H2,(H,22,26) |
| InChIKey | XWJPCNHGDFOETB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide?
The IUPAC name of N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide (CID 18624450) is N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide.
What is the SMILES notation for N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide?
The canonical SMILES for N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide is O=C(NCCCCCCO)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide?
The InChIKey is XWJPCNHGDFOETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO4/c23-12-6-2-1-5-11-22-21(26)14-9-10-17-18(13-14)20(25)16-8-4-3-7-15(16)19(17)24/h3-4,7-10,13,23H,1-2,5-6,11-12H2,(H,22,26).
What are the key properties of N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide?
N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide has a molecular weight of 351.40 g/mol, XLogP of 2.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-hydroxyhexyl)-9,10-dioxoanthracene-2-carboxamide is sourced from PubChem (CID 18624450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).