About 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium
1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium (PubChem CID 18625024) has the molecular formula C9H19N2+
and a molecular weight of 155.26 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium |
| PubChem CID | 18625024 |
| Molecular Formula | C9H19N2+ |
| Molecular Weight | 155.26 g/mol |
| Exact Mass | 155.15 |
| IUPAC Name | 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C)[N+]1(C(C)C)C=NCC1 |
| InChI | InChI=1S/C9H19N2/c1-8(2)11(9(3)4)6-5-10-7-11/h7-9H,5-6H2,1-4H3/q+1 |
| InChIKey | PHGLUEJWILEHJI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium?
The IUPAC name of 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium (CID 18625024) is 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium is CC(C)[N+]1(C(C)C)C=NCC1.
What is the InChIKey of 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium?
The InChIKey is PHGLUEJWILEHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N2/c1-8(2)11(9(3)4)6-5-10-7-11/h7-9H,5-6H2,1-4H3/q+1.
What are the key properties of 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium?
1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium has a molecular weight of 155.26 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(propan-2-yl)-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 18625024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).