C24H20F6O5S — CID 18625044
[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl] 4-(2-phenoxyethoxy)benzenesulfonate (PubChem CID 18625044) has the molecular formula C24H20F6O5S and a molecular weight of 534.47 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl] 4-(2-phenoxyethoxy)benzenesulfonate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl] 4-(2-phenoxyethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 18625044 |
| Molecular Formula | C24H20F6O5S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl] 4-(2-phenoxyethoxy)benzenesulfonate |
| SMILES | Cc1ccc(C(OS(=O)(=O)c2ccc(OCCOc3ccccc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F6O5S/c1-17-7-9-18(10-8-17)22(23(25,26)27,24(28,29)30)35-36(31,32)21-13-11-20(12-14-21)34-16-15-33-19-5-3-2-4-6-19/h2-14H,15-16H2,1H3 |
| InChIKey | AASLWWMGWUMPQA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|