C21H20F6O4S — CID 18625065
[2-(3-ethenylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-butoxybenzenesulfonate (PubChem CID 18625065) has the molecular formula C21H20F6O4S and a molecular weight of 482.44 g/mol. Its IUPAC name is [2-(3-ethenylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-butoxybenzenesulfonate.
| Compound Name | [2-(3-ethenylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-butoxybenzenesulfonate |
|---|---|
| PubChem CID | 18625065 |
| Molecular Formula | C21H20F6O4S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [2-(3-ethenylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 4-butoxybenzenesulfonate |
| SMILES | C=Cc1cccc(C(OS(=O)(=O)c2ccc(OCCCC)cc2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F6O4S/c1-3-5-13-30-17-9-11-18(12-10-17)32(28,29)31-19(20(22,23)24,21(25,26)27)16-8-6-7-15(4-2)14-16/h4,6-12,14H,2-3,5,13H2,1H3 |
| InChIKey | GDUSFPAHGHLAJV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|