About 2-phenylindole-2,4-diamine
2-phenylindole-2,4-diamine (PubChem CID 18625247) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-phenylindole-2,4-diamine.
Molecular Properties
| Compound Name | 2-phenylindole-2,4-diamine |
| PubChem CID | 18625247 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-phenylindole-2,4-diamine |
| SMILES | Nc1cccc2c1=CC(N)(c1ccccc1)N=2 |
| InChI | InChI=1S/C14H13N3/c15-12-7-4-8-13-11(12)9-14(16,17-13)10-5-2-1-3-6-10/h1-9H,15-16H2 |
| InChIKey | IUYLLUJNDLENRE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylindole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylindole-2,4-diamine?
The IUPAC name of 2-phenylindole-2,4-diamine (CID 18625247) is 2-phenylindole-2,4-diamine.
What is the SMILES notation for 2-phenylindole-2,4-diamine?
The canonical SMILES for 2-phenylindole-2,4-diamine is Nc1cccc2c1=CC(N)(c1ccccc1)N=2.
What is the InChIKey of 2-phenylindole-2,4-diamine?
The InChIKey is IUYLLUJNDLENRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3/c15-12-7-4-8-13-11(12)9-14(16,17-13)10-5-2-1-3-6-10/h1-9H,15-16H2.
What are the key properties of 2-phenylindole-2,4-diamine?
2-phenylindole-2,4-diamine has a molecular weight of 223.28 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylindole-2,4-diamine is sourced from PubChem (CID 18625247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).