C14H12FNO2 — CID 18625313
2-(2-fluorophenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 18625313) has the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2-fluorophenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 18625313 |
| Molecular Formula | C14H12FNO2 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(2-fluorophenyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2C=CCCC2C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C14H12FNO2/c15-11-7-3-4-8-12(11)16-13(17)9-5-1-2-6-10(9)14(16)18/h1,3-5,7-10H,2,6H2 |
| InChIKey | RPVNWMCIJLZGGY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|