C12H20N4O4 — CID 18625467
5-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-propan-2-yltetrazole (PubChem CID 18625467) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-propan-2-yltetrazole.
| Compound Name | 5-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-propan-2-yltetrazole |
|---|---|
| PubChem CID | 18625467 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-propan-2-yltetrazole |
| SMILES | COC1OC(c2nnn(C(C)C)n2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H20N4O4/c1-6(2)16-14-10(13-15-16)8-7-9(11(17-5)18-8)20-12(3,4)19-7/h6-9,11H,1-5H3 |
| InChIKey | GQUGPLGEYZGPRE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |