About 6-cyclopentyl-1,2-dihydropyridine
6-cyclopentyl-1,2-dihydropyridine (PubChem CID 18625672) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-cyclopentyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-cyclopentyl-1,2-dihydropyridine |
| PubChem CID | 18625672 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-cyclopentyl-1,2-dihydropyridine |
| SMILES | C1=CCNC(C2CCCC2)=C1 |
| InChI | InChI=1S/C10H15N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h3-4,7,9,11H,1-2,5-6,8H2 |
| InChIKey | BIYJNPJVQWVXIE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-cyclopentyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-1,2-dihydropyridine?
The IUPAC name of 6-cyclopentyl-1,2-dihydropyridine (CID 18625672) is 6-cyclopentyl-1,2-dihydropyridine.
What is the SMILES notation for 6-cyclopentyl-1,2-dihydropyridine?
The canonical SMILES for 6-cyclopentyl-1,2-dihydropyridine is C1=CCNC(C2CCCC2)=C1.
What is the InChIKey of 6-cyclopentyl-1,2-dihydropyridine?
The InChIKey is BIYJNPJVQWVXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h3-4,7,9,11H,1-2,5-6,8H2.
What are the key properties of 6-cyclopentyl-1,2-dihydropyridine?
6-cyclopentyl-1,2-dihydropyridine has a molecular weight of 149.24 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-1,2-dihydropyridine is sourced from PubChem (CID 18625672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).