About tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane
tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane (PubChem CID 18626092) has the molecular formula C33H36BiN3O3
and a molecular weight of 731.65 g/mol. Its IUPAC name is tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane.
Molecular Properties
| Compound Name | tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane |
| PubChem CID | 18626092 |
| Molecular Formula | C33H36BiN3O3 |
| Molecular Weight | 731.65 g/mol |
| Exact Mass | 731.26 |
| IUPAC Name | tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane |
| SMILES | CC1(C)COC(c2ccc([Bi](c3ccc(C4=NC(C)(C)CO4)cc3)c3ccc(C4=NC(C)(C)CO4)cc3)cc2)=N1 |
| InChI | InChI=1S/3C11H12NO.Bi/c3*1-11(2)8-13-10(12-11)9-6-4-3-5-7-9;/h3*4-7H,8H2,1-2H3; |
| InChIKey | JALMAULTCUZXOM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 731.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane?
The IUPAC name of tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane (CID 18626092) is tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane.
What is the SMILES notation for tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane?
The canonical SMILES for tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane is CC1(C)COC(c2ccc([Bi](c3ccc(C4=NC(C)(C)CO4)cc3)c3ccc(C4=NC(C)(C)CO4)cc3)cc2)=N1.
What is the InChIKey of tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane?
The InChIKey is JALMAULTCUZXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/3C11H12NO.Bi/c3*1-11(2)8-13-10(12-11)9-6-4-3-5-7-9;/h3*4-7H,8H2,1-2H3;.
What are the key properties of tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane?
tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane has a molecular weight of 731.65 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]bismuthane is sourced from PubChem (CID 18626092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).