About 2,9-diazaspiro[4.5]decane
2,9-diazaspiro[4.5]decane (PubChem CID 18626461) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,9-diazaspiro[4.5]decane |
| PubChem CID | 18626461 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2,9-diazaspiro[4.5]decane |
| SMILES | C1CNCC2(C1)CCNC2 |
| InChI | InChI=1S/C8H16N2/c1-2-8(6-9-4-1)3-5-10-7-8/h9-10H,1-7H2 |
| InChIKey | SGLTYXRTDQXURA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-diazaspiro[4.5]decane?
The IUPAC name of 2,9-diazaspiro[4.5]decane (CID 18626461) is 2,9-diazaspiro[4.5]decane.
What is the SMILES notation for 2,9-diazaspiro[4.5]decane?
The canonical SMILES for 2,9-diazaspiro[4.5]decane is C1CNCC2(C1)CCNC2.
What is the InChIKey of 2,9-diazaspiro[4.5]decane?
The InChIKey is SGLTYXRTDQXURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-2-8(6-9-4-1)3-5-10-7-8/h9-10H,1-7H2.
What are the key properties of 2,9-diazaspiro[4.5]decane?
2,9-diazaspiro[4.5]decane has a molecular weight of 140.23 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 18626461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).