C17H16O2 — CID 18626557
[2-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]methanol (PubChem CID 18626557) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]methanol.
| Compound Name | [2-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]methanol |
|---|---|
| PubChem CID | 18626557 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [2-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]methanol |
| SMILES | OCC1(CO)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C17H16O2/c18-11-17(12-19)15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)17/h1-10,18-19H,11-12H2 |
| InChIKey | GSABDAIKLWSEQU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|