About bis(bis(2-ethylhexyl)phosphinate);chromium(2+)
bis(bis(2-ethylhexyl)phosphinate);chromium(2+) (PubChem CID 18626793) has the molecular formula C32H68CrO4P2
and a molecular weight of 630.84 g/mol. Its IUPAC name is bis(bis(2-ethylhexyl)phosphinate);chromium(2+).
Molecular Properties
| Compound Name | bis(bis(2-ethylhexyl)phosphinate);chromium(2+) |
| PubChem CID | 18626793 |
| Molecular Formula | C32H68CrO4P2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | bis(bis(2-ethylhexyl)phosphinate);chromium(2+) |
| SMILES | CCCCC(CC)CP(=O)([O-])CC(CC)CCCC.CCCCC(CC)CP(=O)([O-])CC(CC)CCCC.[Cr+2] |
| InChI | InChI=1S/2C16H35O2P.Cr/c2*1-5-9-11-15(7-3)13-19(17,18)14-16(8-4)12-10-6-2;/h2*15-16H,5-14H2,1-4H3,(H,17,18);/q;;+2/p-2 |
| InChIKey | YRTHBAYIAVHXHC-UHFFFAOYSA-L |
| XLogP | 10.11 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(2-ethylhexyl)phosphinate);chromium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(2-ethylhexyl)phosphinate);chromium(2+)?
The IUPAC name of bis(bis(2-ethylhexyl)phosphinate);chromium(2+) (CID 18626793) is bis(bis(2-ethylhexyl)phosphinate);chromium(2+).
What is the SMILES notation for bis(bis(2-ethylhexyl)phosphinate);chromium(2+)?
The canonical SMILES for bis(bis(2-ethylhexyl)phosphinate);chromium(2+) is CCCCC(CC)CP(=O)([O-])CC(CC)CCCC.CCCCC(CC)CP(=O)([O-])CC(CC)CCCC.[Cr+2].
What is the InChIKey of bis(bis(2-ethylhexyl)phosphinate);chromium(2+)?
The InChIKey is YRTHBAYIAVHXHC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H35O2P.Cr/c2*1-5-9-11-15(7-3)13-19(17,18)14-16(8-4)12-10-6-2;/h2*15-16H,5-14H2,1-4H3,(H,17,18);/q;;+2/p-2.
What are the key properties of bis(bis(2-ethylhexyl)phosphinate);chromium(2+)?
bis(bis(2-ethylhexyl)phosphinate);chromium(2+) has a molecular weight of 630.84 g/mol, XLogP of 10.11, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(2-ethylhexyl)phosphinate);chromium(2+) is sourced from PubChem (CID 18626793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).