About [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid
[1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid (PubChem CID 18627159) has the molecular formula C10H24NO2P
and a molecular weight of 221.28 g/mol. Its IUPAC name is [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid.
Molecular Properties
| Compound Name | [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid |
| PubChem CID | 18627159 |
| Molecular Formula | C10H24NO2P |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid |
| SMILES | CC(C)(C)NC(C(C)(C)C)P(C)(=O)O |
| InChI | InChI=1S/C10H24NO2P/c1-9(2,3)8(14(7,12)13)11-10(4,5)6/h8,11H,1-7H3,(H,12,13) |
| InChIKey | WUNPHQPVMMNQSK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid?
The IUPAC name of [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid (CID 18627159) is [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid.
What is the SMILES notation for [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid?
The canonical SMILES for [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid is CC(C)(C)NC(C(C)(C)C)P(C)(=O)O.
What is the InChIKey of [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid?
The InChIKey is WUNPHQPVMMNQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24NO2P/c1-9(2,3)8(14(7,12)13)11-10(4,5)6/h8,11H,1-7H3,(H,12,13).
What are the key properties of [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid?
[1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid has a molecular weight of 221.28 g/mol, XLogP of 2.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(tert-butylamino)-2,2-dimethylpropyl]-methylphosphinic acid is sourced from PubChem (CID 18627159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).