About bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine
bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine (PubChem CID 18627802) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine.
Molecular Properties
| Compound Name | bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine |
| PubChem CID | 18627802 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine |
| SMILES | NC1=Cc2ccccc21 |
| InChI | InChI=1S/C8H7N/c9-8-5-6-3-1-2-4-7(6)8/h1-5H,9H2 |
| InChIKey | RNKJKBFDTANUPF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine?
The IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine (CID 18627802) is bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine.
What is the SMILES notation for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine?
The canonical SMILES for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine is NC1=Cc2ccccc21.
What is the InChIKey of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine?
The InChIKey is RNKJKBFDTANUPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c9-8-5-6-3-1-2-4-7(6)8/h1-5H,9H2.
What are the key properties of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine?
bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine has a molecular weight of 117.15 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine is sourced from PubChem (CID 18627802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).