About bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride
bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride (PubChem CID 18627824) has the molecular formula C8H8ClN
and a molecular weight of 153.61 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride.
Molecular Properties
| Compound Name | bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride |
| PubChem CID | 18627824 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride |
| SMILES | Cl.NC1=Cc2ccccc21 |
| InChI | InChI=1S/C8H7N.ClH/c9-8-5-6-3-1-2-4-7(6)8;/h1-5H,9H2;1H |
| InChIKey | LLSQIZAJLXREQC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride?
The IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride (CID 18627824) is bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride.
What is the SMILES notation for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride?
The canonical SMILES for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride is Cl.NC1=Cc2ccccc21.
What is the InChIKey of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride?
The InChIKey is LLSQIZAJLXREQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.ClH/c9-8-5-6-3-1-2-4-7(6)8;/h1-5H,9H2;1H.
What are the key properties of bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride?
bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride has a molecular weight of 153.61 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1,3,5,7-tetraen-7-amine;hydrochloride is sourced from PubChem (CID 18627824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).