About (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine
(NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine (PubChem CID 18627844) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine |
| PubChem CID | 18627844 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine |
| SMILES | COc1ccc2c(c1)/C(=N\O)CC2 |
| InChI | InChI=1S/C10H11NO2/c1-13-8-4-2-7-3-5-10(11-12)9(7)6-8/h2,4,6,12H,3,5H2,1H3/b11-10- |
| InChIKey | IBGZGCQWOXMORO-KHPPLWFESA-N |
| XLogP | 1.82 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine (CID 18627844) is (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine is COc1ccc2c(c1)/C(=N\O)CC2.
What is the InChIKey of (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine?
The InChIKey is IBGZGCQWOXMORO-KHPPLWFESA-N. The full InChI is InChI=1S/C10H11NO2/c1-13-8-4-2-7-3-5-10(11-12)9(7)6-8/h2,4,6,12H,3,5H2,1H3/b11-10-.
What are the key properties of (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine?
(NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine has a molecular weight of 177.20 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(6-methoxy-2,3-dihydroinden-1-ylidene)hydroxylamine is sourced from PubChem (CID 18627844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).