About 2-amino-1-(3,4,5-triiodophenyl)ethanol
2-amino-1-(3,4,5-triiodophenyl)ethanol (PubChem CID 18627989) has the molecular formula C8H8I3NO
and a molecular weight of 514.87 g/mol. Its IUPAC name is 2-amino-1-(3,4,5-triiodophenyl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(3,4,5-triiodophenyl)ethanol |
| PubChem CID | 18627989 |
| Molecular Formula | C8H8I3NO |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.77 |
| IUPAC Name | 2-amino-1-(3,4,5-triiodophenyl)ethanol |
| SMILES | NCC(O)c1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C8H8I3NO/c9-5-1-4(7(13)3-12)2-6(10)8(5)11/h1-2,7,13H,3,12H2 |
| InChIKey | KTUSXDKSXRLKGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(3,4,5-triiodophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3,4,5-triiodophenyl)ethanol?
The IUPAC name of 2-amino-1-(3,4,5-triiodophenyl)ethanol (CID 18627989) is 2-amino-1-(3,4,5-triiodophenyl)ethanol.
What is the SMILES notation for 2-amino-1-(3,4,5-triiodophenyl)ethanol?
The canonical SMILES for 2-amino-1-(3,4,5-triiodophenyl)ethanol is NCC(O)c1cc(I)c(I)c(I)c1.
What is the InChIKey of 2-amino-1-(3,4,5-triiodophenyl)ethanol?
The InChIKey is KTUSXDKSXRLKGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8I3NO/c9-5-1-4(7(13)3-12)2-6(10)8(5)11/h1-2,7,13H,3,12H2.
What are the key properties of 2-amino-1-(3,4,5-triiodophenyl)ethanol?
2-amino-1-(3,4,5-triiodophenyl)ethanol has a molecular weight of 514.87 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3,4,5-triiodophenyl)ethanol is sourced from PubChem (CID 18627989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).