C13H9N3O2 — CID 18628380
9-azatricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8,11-hexaene-3,6-dicarboxamide (PubChem CID 18628380) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 9-azatricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8,11-hexaene-3,6-dicarboxamide.
| Compound Name | 9-azatricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8,11-hexaene-3,6-dicarboxamide |
|---|---|
| PubChem CID | 18628380 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 9-azatricyclo[6.2.2.02,7]dodeca-1(10),2,4,6,8,11-hexaene-3,6-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c2c3ccc(cn3)c12 |
| InChI | InChI=1S/C13H9N3O2/c14-12(17)7-2-3-8(13(15)18)11-9-4-1-6(5-16-9)10(7)11/h1-5H,(H2,14,17)(H2,15,18) |
| InChIKey | QJJWUUJWHMOLDV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |