C39H30N2O2 — CID 18628384
1,2-diphenylethane-1,2-dione;4,7-diphenyl-1,10-phenanthroline;methane (PubChem CID 18628384) has the molecular formula C39H30N2O2 and a molecular weight of 558.68 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;4,7-diphenyl-1,10-phenanthroline;methane.
| Compound Name | 1,2-diphenylethane-1,2-dione;4,7-diphenyl-1,10-phenanthroline;methane |
|---|---|
| PubChem CID | 18628384 |
| Molecular Formula | C39H30N2O2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;4,7-diphenyl-1,10-phenanthroline;methane |
| SMILES | C.O=C(C(=O)c1ccccc1)c1ccccc1.c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C14H10O2.CH4/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;/h1-16H;1-10H;1H4 |
| InChIKey | IRYREZRXCXWMMZ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|