About 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide
2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide (PubChem CID 18628809) has the molecular formula C22H20F6N2O
and a molecular weight of 442.40 g/mol. Its IUPAC name is 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide.
Molecular Properties
| Compound Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide |
| PubChem CID | 18628809 |
| Molecular Formula | C22H20F6N2O |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NCC#N)c1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H20F6N2O/c1-13(2)8-19(20(31)30-7-6-29)15-5-3-4-14(9-15)16-10-17(21(23,24)25)12-18(11-16)22(26,27)28/h3-5,9-13,19H,7-8H2,1-2H3,(H,30,31) |
| InChIKey | MVEGSBANKAXTHR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide?
The IUPAC name of 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide (CID 18628809) is 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide.
What is the SMILES notation for 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide?
The canonical SMILES for 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide is CC(C)CC(C(=O)NCC#N)c1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.
What is the InChIKey of 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide?
The InChIKey is MVEGSBANKAXTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F6N2O/c1-13(2)8-19(20(31)30-7-6-29)15-5-3-4-14(9-15)16-10-17(21(23,24)25)12-18(11-16)22(26,27)28/h3-5,9-13,19H,7-8H2,1-2H3,(H,30,31).
What are the key properties of 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide?
2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide has a molecular weight of 442.40 g/mol, XLogP of 6.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-(cyanomethyl)-4-methylpentanamide is sourced from PubChem (CID 18628809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).