About octa-1,7-diene-4,5-diamine
octa-1,7-diene-4,5-diamine (PubChem CID 18628866) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is octa-1,7-diene-4,5-diamine.
Molecular Properties
| Compound Name | octa-1,7-diene-4,5-diamine |
| PubChem CID | 18628866 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | octa-1,7-diene-4,5-diamine |
| SMILES | C=CCC(N)C(N)CC=C |
| InChI | InChI=1S/C8H16N2/c1-3-5-7(9)8(10)6-4-2/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | MRLXGFBWLDCANI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octa-1,7-diene-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octa-1,7-diene-4,5-diamine?
The IUPAC name of octa-1,7-diene-4,5-diamine (CID 18628866) is octa-1,7-diene-4,5-diamine.
What is the SMILES notation for octa-1,7-diene-4,5-diamine?
The canonical SMILES for octa-1,7-diene-4,5-diamine is C=CCC(N)C(N)CC=C.
What is the InChIKey of octa-1,7-diene-4,5-diamine?
The InChIKey is MRLXGFBWLDCANI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-5-7(9)8(10)6-4-2/h3-4,7-8H,1-2,5-6,9-10H2.
What are the key properties of octa-1,7-diene-4,5-diamine?
octa-1,7-diene-4,5-diamine has a molecular weight of 140.23 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octa-1,7-diene-4,5-diamine is sourced from PubChem (CID 18628866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).