C14H10F3NO3 — CID 18629053
2-(1,3-benzodioxol-5-ylmethoxy)-3,5,6-trifluoro-4-methylpyridine (PubChem CID 18629053) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)-3,5,6-trifluoro-4-methylpyridine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)-3,5,6-trifluoro-4-methylpyridine |
|---|---|
| PubChem CID | 18629053 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)-3,5,6-trifluoro-4-methylpyridine |
| SMILES | Cc1c(F)c(F)nc(OCc2ccc3c(c2)OCO3)c1F |
| InChI | InChI=1S/C14H10F3NO3/c1-7-11(15)13(17)18-14(12(7)16)19-5-8-2-3-9-10(4-8)21-6-20-9/h2-4H,5-6H2,1H3 |
| InChIKey | ISJAODWXMLNBMP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|