About 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine
2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine (PubChem CID 18629059) has the molecular formula C14H12FNO5
and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine |
| PubChem CID | 18629059 |
| Molecular Formula | C14H12FNO5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine |
| SMILES | COc1cc(OC)c(Oc2ccc3c(c2)OCO3)nc1F |
| InChI | InChI=1S/C14H12FNO5/c1-17-11-6-12(18-2)14(16-13(11)15)21-8-3-4-9-10(5-8)20-7-19-9/h3-6H,7H2,1-2H3 |
| InChIKey | AARUFSHJVPRGSM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine?
The IUPAC name of 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine (CID 18629059) is 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine is COc1cc(OC)c(Oc2ccc3c(c2)OCO3)nc1F.
What is the InChIKey of 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine?
The InChIKey is AARUFSHJVPRGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO5/c1-17-11-6-12(18-2)14(16-13(11)15)21-8-3-4-9-10(5-8)20-7-19-9/h3-6H,7H2,1-2H3.
What are the key properties of 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine?
2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine has a molecular weight of 293.25 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yloxy)-6-fluoro-3,5-dimethoxypyridine is sourced from PubChem (CID 18629059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).