C13H8F3NO3 — CID 18629114
2-(1,3-benzodioxol-5-yloxy)-3,5,6-trifluoro-4-methylpyridine (PubChem CID 18629114) has the molecular formula C13H8F3NO3 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trifluoro-4-methylpyridine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trifluoro-4-methylpyridine |
|---|---|
| PubChem CID | 18629114 |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-3,5,6-trifluoro-4-methylpyridine |
| SMILES | Cc1c(F)c(F)nc(Oc2ccc3c(c2)OCO3)c1F |
| InChI | InChI=1S/C13H8F3NO3/c1-6-10(14)12(16)17-13(11(6)15)20-7-2-3-8-9(4-7)19-5-18-8/h2-4H,5H2,1H3 |
| InChIKey | ZALSSKJVGXJIMZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|