About [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea
[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea (PubChem CID 18629130) has the molecular formula C13H10FN3O4
and a molecular weight of 291.24 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea.
Molecular Properties
| Compound Name | [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea |
| PubChem CID | 18629130 |
| Molecular Formula | C13H10FN3O4 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea |
| SMILES | NC(=O)Nc1ccc(Oc2ccc3c(c2)OCO3)nc1F |
| InChI | InChI=1S/C13H10FN3O4/c14-12-8(16-13(15)18)2-4-11(17-12)21-7-1-3-9-10(5-7)20-6-19-9/h1-5H,6H2,(H3,15,16,18) |
| InChIKey | SBOPBZCKUCNASD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea?
The IUPAC name of [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea (CID 18629130) is [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea.
What is the SMILES notation for [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea?
The canonical SMILES for [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea is NC(=O)Nc1ccc(Oc2ccc3c(c2)OCO3)nc1F.
What is the InChIKey of [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea?
The InChIKey is SBOPBZCKUCNASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O4/c14-12-8(16-13(15)18)2-4-11(17-12)21-7-1-3-9-10(5-7)20-6-19-9/h1-5H,6H2,(H3,15,16,18).
What are the key properties of [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea?
[6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea has a molecular weight of 291.24 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,3-benzodioxol-5-yloxy)-2-fluoro-3-pyridinyl]urea is sourced from PubChem (CID 18629130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).