C11H15ClN4O — CID 18629214
4-chloro-1-(1-methoxybutan-2-yl)-6-methyltriazolo[4,5-c]pyridine (PubChem CID 18629214) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 4-chloro-1-(1-methoxybutan-2-yl)-6-methyltriazolo[4,5-c]pyridine.
| Compound Name | 4-chloro-1-(1-methoxybutan-2-yl)-6-methyltriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 18629214 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-chloro-1-(1-methoxybutan-2-yl)-6-methyltriazolo[4,5-c]pyridine |
| SMILES | CCC(COC)n1nnc2c(Cl)nc(C)cc21 |
| InChI | InChI=1S/C11H15ClN4O/c1-4-8(6-17-3)16-9-5-7(2)13-11(12)10(9)14-15-16/h5,8H,4,6H2,1-3H3 |
| InChIKey | PFRHCLYHUKGRDC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|