About 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid
1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid (PubChem CID 18629328) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid |
| PubChem CID | 18629328 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid |
| SMILES | Cc1c(-c2ccc3c(c2)CNC3)ccn2c(=O)c(C(=O)O)cc(C3CC3)c12 |
| InChI | InChI=1S/C22H20N2O3/c1-12-17(14-4-5-15-10-23-11-16(15)8-14)6-7-24-20(12)18(13-2-3-13)9-19(21(24)25)22(26)27/h4-9,13,23H,2-3,10-11H2,1H3,(H,26,27) |
| InChIKey | RHTPORVKPVIIDX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid?
The IUPAC name of 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid (CID 18629328) is 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid.
What is the SMILES notation for 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid?
The canonical SMILES for 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid is Cc1c(-c2ccc3c(c2)CNC3)ccn2c(=O)c(C(=O)O)cc(C3CC3)c12.
What is the InChIKey of 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid?
The InChIKey is RHTPORVKPVIIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-12-17(14-4-5-15-10-23-11-16(15)8-14)6-7-24-20(12)18(13-2-3-13)9-19(21(24)25)22(26)27/h4-9,13,23H,2-3,10-11H2,1H3,(H,26,27).
What are the key properties of 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid?
1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid has a molecular weight of 360.41 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-8-(2,3-dihydro-1H-isoindol-5-yl)-9-methyl-4-oxoquinolizine-3-carboxylic acid is sourced from PubChem (CID 18629328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).