C11H19N5O6S — CID 18629419
2-acetamido-4-methylsulfanylbutanoic acid;(2,5-dioxoimidazolidin-4-yl)urea (PubChem CID 18629419) has the molecular formula C11H19N5O6S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-acetamido-4-methylsulfanylbutanoic acid;(2,5-dioxoimidazolidin-4-yl)urea.
| Compound Name | 2-acetamido-4-methylsulfanylbutanoic acid;(2,5-dioxoimidazolidin-4-yl)urea |
|---|---|
| PubChem CID | 18629419 |
| Molecular Formula | C11H19N5O6S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-acetamido-4-methylsulfanylbutanoic acid;(2,5-dioxoimidazolidin-4-yl)urea |
| SMILES | CSCCC(NC(C)=O)C(=O)O.NC(=O)NC1NC(=O)NC1=O |
| InChI | InChI=1S/C7H13NO3S.C4H6N4O3/c1-5(9)8-6(7(10)11)3-4-12-2;5-3(10)6-1-2(9)8-4(11)7-1/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11);1H,(H3,5,6,10)(H2,7,8,9,11) |
| InChIKey | LWNZJCOLRQMXHS-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|